C23H22N2O5 — CID 70490785
(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-9-oxo-2,10-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3(8),14-triene-13-carboxylic acid (PubChem CID 70490785) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is (4E)-4-[(2,3-dimethoxyphenyl)methylidene]-9-oxo-2,10-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3(8),14-triene-13-carboxylic acid.
| Compound Name | (4E)-4-[(2,3-dimethoxyphenyl)methylidene]-9-oxo-2,10-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3(8),14-triene-13-carboxylic acid |
|---|---|
| PubChem CID | 70490785 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (4E)-4-[(2,3-dimethoxyphenyl)methylidene]-9-oxo-2,10-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3(8),14-triene-13-carboxylic acid |
| SMILES | COc1cccc(/C=C2\CCCc3c2nc2n(c3=O)C3CC3(C(=O)O)C=C2)c1OC |
| InChI | InChI=1S/C23H22N2O5/c1-29-16-8-4-6-14(20(16)30-2)11-13-5-3-7-15-19(13)24-18-9-10-23(22(27)28)12-17(23)25(18)21(15)26/h4,6,8-11,17H,3,5,7,12H2,1-2H3,(H,27,28)/b13-11+ |
| InChIKey | FDJGREFLACYMLE-ACCUITESSA-N |
| XLogP | 3.18 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |