C23H25NO4 — CID 24897851
N-(6,7,8,9,10,11-hexahydrocycloocta[b][1]benzofuran-2-yl)-2,6-dimethoxybenzamide (PubChem CID 24897851) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(6,7,8,9,10,11-hexahydrocycloocta[b][1]benzofuran-2-yl)-2,6-dimethoxybenzamide.
| Compound Name | N-(6,7,8,9,10,11-hexahydrocycloocta[b][1]benzofuran-2-yl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 24897851 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-(6,7,8,9,10,11-hexahydrocycloocta[b][1]benzofuran-2-yl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc2oc3c(c2c1)CCCCCC3 |
| InChI | InChI=1S/C23H25NO4/c1-26-20-10-7-11-21(27-2)22(20)23(25)24-15-12-13-19-17(14-15)16-8-5-3-4-6-9-18(16)28-19/h7,10-14H,3-6,8-9H2,1-2H3,(H,24,25) |
| InChIKey | QTWXQOOMJOPDQH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |