C60H44Cl4N4O2 — CID 139200178
10-chloro-4-(4-chlorophenyl)-2-ethoxy-12-phenyl-5,6-dihydrobenzo[j][1,7]phenanthroline (PubChem CID 139200178) has the molecular formula C60H44Cl4N4O2 and a molecular weight of 994.85 g/mol. Its IUPAC name is 10-chloro-4-(4-chlorophenyl)-2-ethoxy-12-phenyl-5,6-dihydrobenzo[j][1,7]phenanthroline.
| Compound Name | 10-chloro-4-(4-chlorophenyl)-2-ethoxy-12-phenyl-5,6-dihydrobenzo[j][1,7]phenanthroline |
|---|---|
| PubChem CID | 139200178 |
| Molecular Formula | C60H44Cl4N4O2 |
| Molecular Weight | 994.85 g/mol |
| Exact Mass | 992.22 |
| IUPAC Name | 10-chloro-4-(4-chlorophenyl)-2-ethoxy-12-phenyl-5,6-dihydrobenzo[j][1,7]phenanthroline |
| SMILES | CCOc1cc(-c2ccc(Cl)cc2)c2c(n1)-c1c(nc3ccc(Cl)cc3c1-c1ccccc1)CC2.CCOc1cc(-c2ccc(Cl)cc2)c2c(n1)-c1c(nc3ccc(Cl)cc3c1-c1ccccc1)CC2 |
| InChI | InChI=1S/2C30H22Cl2N2O/c2*1-2-35-27-17-23(18-8-10-20(31)11-9-18)22-13-15-26-29(30(22)34-27)28(19-6-4-3-5-7-19)24-16-21(32)12-14-25(24)33-26/h2*3-12,14,16-17H,2,13,15H2,1H3 |
| InChIKey | DTELZMWJXRMQQQ-UHFFFAOYSA-N |
| XLogP | 16.87 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.85 |
| LogP ≤ 5 | 16.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |