C10H6ClNO — CID 55295556
6-chloro-3-oxo-1,2-dihydroindene-4-carbonitrile (PubChem CID 55295556) has the molecular formula C10H6ClNO and a molecular weight of 191.62 g/mol. Its IUPAC name is 6-chloro-3-oxo-1,2-dihydroindene-4-carbonitrile.
| Compound Name | 6-chloro-3-oxo-1,2-dihydroindene-4-carbonitrile |
|---|---|
| PubChem CID | 55295556 |
| Molecular Formula | C10H6ClNO |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | 6-chloro-3-oxo-1,2-dihydroindene-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)cc2c1C(=O)CC2 |
| InChI | InChI=1S/C10H6ClNO/c11-8-3-6-1-2-9(13)10(6)7(4-8)5-12/h3-4H,1-2H2 |
| InChIKey | KPXTUNWNZLMVAY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |