C16H11ClN2O2 — CID 62492902
5-chloro-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile (PubChem CID 62492902) has the molecular formula C16H11ClN2O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 5-chloro-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile.
| Compound Name | 5-chloro-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 62492902 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 5-chloro-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1Oc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C16H11ClN2O2/c17-12-2-5-15(11(7-12)9-18)21-13-3-4-14-10(8-13)1-6-16(20)19-14/h2-5,7-8H,1,6H2,(H,19,20) |
| InChIKey | BGCPUDJAZPMNFX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |