About (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride
(6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride (PubChem CID 168792063) has the molecular formula C10H10Cl2N2
and a molecular weight of 229.11 g/mol. Its IUPAC name is (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride.
Analyze (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride?
The IUPAC name of (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride (CID 168792063) is (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride.
What is the SMILES notation for (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride?
The canonical SMILES for (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride is N#Cc1cc(Cl)cc2c1CC([NH3+])C2.[Cl-].
What is the InChIKey of (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride?
The InChIKey is KUPRHGVVBDVZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2.ClH/c11-8-1-6-3-9(13)4-10(6)7(2-8)5-12;/h1-2,9H,3-4,13H2;1H.
What are the key properties of (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride?
(6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride has a molecular weight of 229.11 g/mol, XLogP of -2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4-cyano-2,3-dihydro-1H-inden-2-yl)azanium chloride is sourced from PubChem (CID 168792063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).