C10H10BrCl2NO2 — CID 58602710
2-bromo-6,9-dichloro-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol (PubChem CID 58602710) has the molecular formula C10H10BrCl2NO2 and a molecular weight of 327.01 g/mol. Its IUPAC name is 2-bromo-6,9-dichloro-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol.
| Compound Name | 2-bromo-6,9-dichloro-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 58602710 |
| Molecular Formula | C10H10BrCl2NO2 |
| Molecular Weight | 327.01 g/mol |
| Exact Mass | 324.93 |
| IUPAC Name | 2-bromo-6,9-dichloro-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol |
| SMILES | Oc1c(O)c(Cl)c2c(c1Cl)CCCN(Br)C2 |
| InChI | InChI=1S/C10H10BrCl2NO2/c11-14-3-1-2-5-6(4-14)8(13)10(16)9(15)7(5)12/h15-16H,1-4H2 |
| InChIKey | MCCMZSLQHYNFGA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.01 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|