C20H20Cl2FN3O3 — CID 146294783
(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-[1-(5-fluoro-2-pyridinyl)piperidin-3-yl]methanone (PubChem CID 146294783) has the molecular formula C20H20Cl2FN3O3 and a molecular weight of 440.30 g/mol. Its IUPAC name is (5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-[1-(5-fluoro-2-pyridinyl)piperidin-3-yl]methanone.
| Compound Name | (5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-[1-(5-fluoro-2-pyridinyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 146294783 |
| Molecular Formula | C20H20Cl2FN3O3 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-[1-(5-fluoro-2-pyridinyl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(c2ccc(F)cn2)C1)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1 |
| InChI | InChI=1S/C20H20Cl2FN3O3/c21-16-13-5-7-26(10-14(13)17(22)19(28)18(16)27)20(29)11-2-1-6-25(9-11)15-4-3-12(23)8-24-15/h3-4,8,11,27-28H,1-2,5-7,9-10H2 |
| InChIKey | GELDKNXMFRXGGZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|