C21H25Cl2NO2 — CID 141119515
2-[2-(4-tert-butylphenyl)ethyl]-5,8-dichloro-3,4-dihydro-1H-isoquinoline-6,7-diol (PubChem CID 141119515) has the molecular formula C21H25Cl2NO2 and a molecular weight of 394.34 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)ethyl]-5,8-dichloro-3,4-dihydro-1H-isoquinoline-6,7-diol.
| Compound Name | 2-[2-(4-tert-butylphenyl)ethyl]-5,8-dichloro-3,4-dihydro-1H-isoquinoline-6,7-diol |
|---|---|
| PubChem CID | 141119515 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)ethyl]-5,8-dichloro-3,4-dihydro-1H-isoquinoline-6,7-diol |
| SMILES | CC(C)(C)c1ccc(CCN2CCc3c(Cl)c(O)c(O)c(Cl)c3C2)cc1 |
| InChI | InChI=1S/C21H25Cl2NO2/c1-21(2,3)14-6-4-13(5-7-14)8-10-24-11-9-15-16(12-24)18(23)20(26)19(25)17(15)22/h4-7,25-26H,8-12H2,1-3H3 |
| InChIKey | DDUQGVRQXFZXTP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|