C27H31FN2O3S — CID 118074354
2-[2-(4-tert-butylphenyl)ethyl]-N-(2-fluoro-4-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 118074354) has the molecular formula C27H31FN2O3S and a molecular weight of 482.62 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)ethyl]-N-(2-fluoro-4-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | 2-[2-(4-tert-butylphenyl)ethyl]-N-(2-fluoro-4-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 118074354 |
| Molecular Formula | C27H31FN2O3S |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)ethyl]-N-(2-fluoro-4-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | CC(C)(C)c1ccc(CCN2CCc3cc(S(=O)(=O)Nc4ccc(O)cc4F)ccc3C2)cc1 |
| InChI | InChI=1S/C27H31FN2O3S/c1-27(2,3)22-7-4-19(5-8-22)12-14-30-15-13-20-16-24(10-6-21(20)18-30)34(32,33)29-26-11-9-23(31)17-25(26)28/h4-11,16-17,29,31H,12-15,18H2,1-3H3 |
| InChIKey | KNBSRDQGUCYETL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|