C32H30F4N2O3S — CID 118074276
N-[2-fluoro-4-(3-phenylpropoxy)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 118074276) has the molecular formula C32H30F4N2O3S and a molecular weight of 598.66 g/mol. Its IUPAC name is N-[2-fluoro-4-(3-phenylpropoxy)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | N-[2-fluoro-4-(3-phenylpropoxy)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 118074276 |
| Molecular Formula | C32H30F4N2O3S |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | N-[2-fluoro-4-(3-phenylpropoxy)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OCCCc2ccccc2)cc1F)c1ccc2c(c1)CCN(Cc1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C32H30F4N2O3S/c33-30-20-28(41-18-4-7-23-5-2-1-3-6-23)13-15-31(30)37-42(39,40)29-14-10-26-22-38(17-16-25(26)19-29)21-24-8-11-27(12-9-24)32(34,35)36/h1-3,5-6,8-15,19-20,37H,4,7,16-18,21-22H2 |
| InChIKey | IFGDINNTZOUFLA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|