C29H31F5N2O3S — CID 118074320
N-(2-fluoro-4-hexoxyphenyl)-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 118074320) has the molecular formula C29H31F5N2O3S and a molecular weight of 582.64 g/mol. Its IUPAC name is N-(2-fluoro-4-hexoxyphenyl)-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | N-(2-fluoro-4-hexoxyphenyl)-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 118074320 |
| Molecular Formula | C29H31F5N2O3S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | N-(2-fluoro-4-hexoxyphenyl)-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | CCCCCCOc1ccc(NS(=O)(=O)c2ccc3c(c2)CCN(Cc2cc(F)cc(C(F)(F)F)c2)C3)c(F)c1 |
| InChI | InChI=1S/C29H31F5N2O3S/c1-2-3-4-5-12-39-25-7-9-28(27(31)17-25)35-40(37,38)26-8-6-22-19-36(11-10-21(22)15-26)18-20-13-23(29(32,33)34)16-24(30)14-20/h6-9,13-17,35H,2-5,10-12,18-19H2,1H3 |
| InChIKey | MQXVNDITTVKINZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|