C32H42FN3O2S — CID 102594321
2-[(6-tert-butyl-3-pyridinyl)methyl]-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 102594321) has the molecular formula C32H42FN3O2S and a molecular weight of 551.77 g/mol. Its IUPAC name is 2-[(6-tert-butyl-3-pyridinyl)methyl]-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | 2-[(6-tert-butyl-3-pyridinyl)methyl]-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 102594321 |
| Molecular Formula | C32H42FN3O2S |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 2-[(6-tert-butyl-3-pyridinyl)methyl]-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | CCCCCCCc1ccc(NS(=O)(=O)c2ccc3c(c2)CCN(Cc2ccc(C(C)(C)C)nc2)C3)c(F)c1 |
| InChI | InChI=1S/C32H42FN3O2S/c1-5-6-7-8-9-10-24-11-15-30(29(33)19-24)35-39(37,38)28-14-13-27-23-36(18-17-26(27)20-28)22-25-12-16-31(34-21-25)32(2,3)4/h11-16,19-21,35H,5-10,17-18,22-23H2,1-4H3 |
| InChIKey | PKRRKQMWCBOFKF-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|