C28H31F3N2O3S — CID 118074316
2-[(2,4-difluorophenyl)methyl]-N-(2-fluoro-4-hexoxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 118074316) has the molecular formula C28H31F3N2O3S and a molecular weight of 532.63 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-N-(2-fluoro-4-hexoxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-N-(2-fluoro-4-hexoxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 118074316 |
| Molecular Formula | C28H31F3N2O3S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-N-(2-fluoro-4-hexoxyphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | CCCCCCOc1ccc(NS(=O)(=O)c2ccc3c(c2)CCN(Cc2ccc(F)cc2F)C3)c(F)c1 |
| InChI | InChI=1S/C28H31F3N2O3S/c1-2-3-4-5-14-36-24-9-11-28(27(31)17-24)32-37(34,35)25-10-7-21-18-33(13-12-20(21)15-25)19-22-6-8-23(29)16-26(22)30/h6-11,15-17,32H,2-5,12-14,18-19H2,1H3 |
| InChIKey | PGHKQZYJZRQVJY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|