C27H37Cl2FN2O2S — CID 118074335
2-(2,2-dichloropentyl)-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 118074335) has the molecular formula C27H37Cl2FN2O2S and a molecular weight of 543.58 g/mol. Its IUPAC name is 2-(2,2-dichloropentyl)-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | 2-(2,2-dichloropentyl)-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 118074335 |
| Molecular Formula | C27H37Cl2FN2O2S |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-(2,2-dichloropentyl)-N-(2-fluoro-4-heptylphenyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | CCCCCCCc1ccc(NS(=O)(=O)c2ccc3c(c2)CCN(CC(Cl)(Cl)CCC)C3)c(F)c1 |
| InChI | InChI=1S/C27H37Cl2FN2O2S/c1-3-5-6-7-8-9-21-10-13-26(25(30)17-21)31-35(33,34)24-12-11-23-19-32(16-14-22(23)18-24)20-27(28,29)15-4-2/h10-13,17-18,31H,3-9,14-16,19-20H2,1-2H3 |
| InChIKey | VWDDNCWOSKGYGT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|