C36H42N2O3S — CID 118074275
2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-phenylpropoxy)phenyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 118074275) has the molecular formula C36H42N2O3S and a molecular weight of 582.81 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-phenylpropoxy)phenyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | 2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-phenylpropoxy)phenyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 118074275 |
| Molecular Formula | C36H42N2O3S |
| Molecular Weight | 582.81 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-phenylpropoxy)phenyl]-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | CC(C)(C)c1ccc(CCN2CCc3cc(S(=O)(=O)Nc4ccc(OCCCc5ccccc5)cc4)ccc3C2)cc1 |
| InChI | InChI=1S/C36H42N2O3S/c1-36(2,3)32-14-11-29(12-15-32)21-23-38-24-22-30-26-35(20-13-31(30)27-38)42(39,40)37-33-16-18-34(19-17-33)41-25-7-10-28-8-5-4-6-9-28/h4-6,8-9,11-20,26,37H,7,10,21-25,27H2,1-3H3 |
| InChIKey | AGRDJVLBVFCISS-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.81 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|