C36H48FIN2O2S — CID 66547584
2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-cyclopentylpropyl)-2-fluorophenyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-6-sulfonamide iodide (PubChem CID 66547584) has the molecular formula C36H48FIN2O2S and a molecular weight of 718.76 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-cyclopentylpropyl)-2-fluorophenyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-6-sulfonamide iodide.
| Compound Name | 2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-cyclopentylpropyl)-2-fluorophenyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-6-sulfonamide iodide |
|---|---|
| PubChem CID | 66547584 |
| Molecular Formula | C36H48FIN2O2S |
| Molecular Weight | 718.76 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)ethyl]-N-[4-(3-cyclopentylpropyl)-2-fluorophenyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-6-sulfonamide iodide |
| SMILES | CC(C)(C)c1ccc(CC[N+]2(C)CCc3cc(S(=O)(=O)Nc4ccc(CCCC5CCCC5)cc4F)ccc3C2)cc1.[I-] |
| InChI | InChI=1S/C36H48FN2O2S.HI/c1-36(2,3)32-16-12-28(13-17-32)20-22-39(4)23-21-30-25-33(18-15-31(30)26-39)42(40,41)38-35-19-14-29(24-34(35)37)11-7-10-27-8-5-6-9-27;/h12-19,24-25,27,38H,5-11,20-23,26H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | VZJWTAROKZEHNN-UHFFFAOYSA-M |
| XLogP | 5.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.76 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|