C19H18Cl2F3NO4 — CID 143741077
[(3Z,5E)-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienyl] 5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 143741077) has the molecular formula C19H18Cl2F3NO4 and a molecular weight of 452.26 g/mol. Its IUPAC name is [(3Z,5E)-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienyl] 5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | [(3Z,5E)-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienyl] 5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 143741077 |
| Molecular Formula | C19H18Cl2F3NO4 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [(3Z,5E)-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienyl] 5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=C(/C=C\C(=C/C)C(F)(F)F)COC(=O)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1 |
| InChI | InChI=1S/C19H18Cl2F3NO4/c1-3-11(19(22,23)24)5-4-10(2)9-29-18(28)25-7-6-12-13(8-25)15(21)17(27)16(26)14(12)20/h3-5,26-27H,2,6-9H2,1H3/b5-4-,11-3+ |
| InChIKey | BZASOQSJNPXXOJ-NEPXUXLISA-N |
| XLogP | 5.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|