C19H19Cl2FN2O3 — CID 25159708
1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(5-fluoro-6-methyl-2-pyridinyl)butan-1-one (PubChem CID 25159708) has the molecular formula C19H19Cl2FN2O3 and a molecular weight of 413.28 g/mol. Its IUPAC name is 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(5-fluoro-6-methyl-2-pyridinyl)butan-1-one.
| Compound Name | 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(5-fluoro-6-methyl-2-pyridinyl)butan-1-one |
|---|---|
| PubChem CID | 25159708 |
| Molecular Formula | C19H19Cl2FN2O3 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(5-fluoro-6-methyl-2-pyridinyl)butan-1-one |
| SMILES | Cc1nc(CCCC(=O)N2CCc3c(Cl)c(O)c(O)c(Cl)c3C2)ccc1F |
| InChI | InChI=1S/C19H19Cl2FN2O3/c1-10-14(22)6-5-11(23-10)3-2-4-15(25)24-8-7-12-13(9-24)17(21)19(27)18(26)16(12)20/h5-6,26-27H,2-4,7-9H2,1H3 |
| InChIKey | MTYRVVRCPBINTH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|