C11H11ClFNO2 — CID 167949885
2-chloro-1-(8-fluoro-5-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone (PubChem CID 167949885) has the molecular formula C11H11ClFNO2 and a molecular weight of 243.66 g/mol. Its IUPAC name is 2-chloro-1-(8-fluoro-5-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone.
| Compound Name | 2-chloro-1-(8-fluoro-5-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 167949885 |
| Molecular Formula | C11H11ClFNO2 |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-chloro-1-(8-fluoro-5-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
| SMILES | O=C(CCl)N1CCc2c(O)ccc(F)c2C1 |
| InChI | InChI=1S/C11H11ClFNO2/c12-5-11(16)14-4-3-7-8(6-14)9(13)1-2-10(7)15/h1-2,15H,3-6H2 |
| InChIKey | GBZPIUOWTVLJIO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|