C11H10ClN3OS — CID 171327857
2-chloro-1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone (PubChem CID 171327857) has the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. Its IUPAC name is 2-chloro-1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone.
| Compound Name | 2-chloro-1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone |
|---|---|
| PubChem CID | 171327857 |
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 2-chloro-1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone |
| SMILES | O=C(CCl)N1CCc2c(sc3ncncc23)C1 |
| InChI | InChI=1S/C11H10ClN3OS/c12-3-10(16)15-2-1-7-8-4-13-6-14-11(8)17-9(7)5-15/h4,6H,1-3,5H2 |
| InChIKey | UONGZVDZETZTQF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|