C17H23N5O3S2 — CID 25391666
(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-(1-ethylsulfonylpiperidin-4-yl)methanone (PubChem CID 25391666) has the molecular formula C17H23N5O3S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is (3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-(1-ethylsulfonylpiperidin-4-yl)methanone.
| Compound Name | (3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-(1-ethylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 25391666 |
| Molecular Formula | C17H23N5O3S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-(1-ethylsulfonylpiperidin-4-yl)methanone |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)N2CCc3c(sc4ncnc(N)c34)C2)CC1 |
| InChI | InChI=1S/C17H23N5O3S2/c1-2-27(24,25)22-7-3-11(4-8-22)17(23)21-6-5-12-13(9-21)26-16-14(12)15(18)19-10-20-16/h10-11H,2-9H2,1H3,(H2,18,19,20) |
| InChIKey | PSUJDRZXIOKNFH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |