C18H18N6O2S2 — CID 25391895
1-[4-[2-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-2-oxoethyl]-1,3-thiazol-2-yl]pyrrolidin-2-one (PubChem CID 25391895) has the molecular formula C18H18N6O2S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is 1-[4-[2-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-2-oxoethyl]-1,3-thiazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[4-[2-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-2-oxoethyl]-1,3-thiazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 25391895 |
| Molecular Formula | C18H18N6O2S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1-[4-[2-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-2-oxoethyl]-1,3-thiazol-2-yl]pyrrolidin-2-one |
| SMILES | Nc1ncnc2sc3c(c12)CCN(C(=O)Cc1csc(N2CCCC2=O)n1)C3 |
| InChI | InChI=1S/C18H18N6O2S2/c19-16-15-11-3-5-23(7-12(11)28-17(15)21-9-20-16)14(26)6-10-8-27-18(22-10)24-4-1-2-13(24)25/h8-9H,1-7H2,(H2,19,20,21) |
| InChIKey | VNVPYOVZOQLQHP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |