C20H18Cl2F2N2O3 — CID 59526487
(E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[6-(1,1-difluoroethyl)-3-pyridinyl]but-2-en-1-one (PubChem CID 59526487) has the molecular formula C20H18Cl2F2N2O3 and a molecular weight of 443.28 g/mol. Its IUPAC name is (E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[6-(1,1-difluoroethyl)-3-pyridinyl]but-2-en-1-one.
| Compound Name | (E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[6-(1,1-difluoroethyl)-3-pyridinyl]but-2-en-1-one |
|---|---|
| PubChem CID | 59526487 |
| Molecular Formula | C20H18Cl2F2N2O3 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[6-(1,1-difluoroethyl)-3-pyridinyl]but-2-en-1-one |
| SMILES | C/C(=C\C(=O)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1)c1ccc(C(C)(F)F)nc1 |
| InChI | InChI=1S/C20H18Cl2F2N2O3/c1-10(11-3-4-14(25-8-11)20(2,23)24)7-15(27)26-6-5-12-13(9-26)17(22)19(29)18(28)16(12)21/h3-4,7-8,28-29H,5-6,9H2,1-2H3/b10-7+ |
| InChIKey | PTUAVHJCZKQHOZ-JXMROGBWSA-N |
| XLogP | 4.90 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|