C19H17Cl2FN2O3 — CID 59526486
(E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)prop-2-en-1-one (PubChem CID 59526486) has the molecular formula C19H17Cl2FN2O3 and a molecular weight of 411.26 g/mol. Its IUPAC name is (E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59526486 |
| Molecular Formula | C19H17Cl2FN2O3 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)prop-2-en-1-one |
| SMILES | COc1c(Cl)c2c(c(Cl)c1OC)CN(C(=O)/C=C/c1ccc(F)cn1)CC2 |
| InChI | InChI=1S/C19H17Cl2FN2O3/c1-26-18-16(20)13-7-8-24(10-14(13)17(21)19(18)27-2)15(25)6-5-12-4-3-11(22)9-23-12/h3-6,9H,7-8,10H2,1-2H3/b6-5+ |
| InChIKey | KKKXSZGCJISDDA-AATRIKPKSA-N |
| XLogP | 4.14 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|