C19H18Cl2N2O3 — CID 68516173
1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 68516173) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | 1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 68516173 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | COc1c(Cl)c2c(c(Cl)c1OC)CN(C(=O)C=Cc1cccnc1)CC2 |
| InChI | InChI=1S/C19H18Cl2N2O3/c1-25-18-16(20)13-7-9-23(11-14(13)17(21)19(18)26-2)15(24)6-5-12-4-3-8-22-10-12/h3-6,8,10H,7,9,11H2,1-2H3 |
| InChIKey | TUSBSAWQCCNKKS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|