C20H19Cl2FN2O3 — CID 59526483
(E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one (PubChem CID 59526483) has the molecular formula C20H19Cl2FN2O3 and a molecular weight of 425.29 g/mol. Its IUPAC name is (E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one.
| Compound Name | (E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one |
|---|---|
| PubChem CID | 59526483 |
| Molecular Formula | C20H19Cl2FN2O3 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (E)-1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one |
| SMILES | COc1c(Cl)c2c(c(Cl)c1OC)CN(C(=O)/C=C(\C)c1ccc(F)cn1)CC2 |
| InChI | InChI=1S/C20H19Cl2FN2O3/c1-11(15-5-4-12(23)9-24-15)8-16(26)25-7-6-13-14(10-25)18(22)20(28-3)19(27-2)17(13)21/h4-5,8-9H,6-7,10H2,1-3H3/b11-8+ |
| InChIKey | KOSBXOLGJWFXKL-DHZHZOJOSA-N |
| XLogP | 4.53 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|