C14H19ClN2O4 — CID 18797679
(E)-3-(4,5-dimethoxy-2-pyridinyl)-1-morpholin-4-ylprop-2-en-1-one;hydrochloride (PubChem CID 18797679) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is (E)-3-(4,5-dimethoxy-2-pyridinyl)-1-morpholin-4-ylprop-2-en-1-one;hydrochloride.
| Compound Name | (E)-3-(4,5-dimethoxy-2-pyridinyl)-1-morpholin-4-ylprop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 18797679 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (E)-3-(4,5-dimethoxy-2-pyridinyl)-1-morpholin-4-ylprop-2-en-1-one;hydrochloride |
| SMILES | COc1cnc(/C=C/C(=O)N2CCOCC2)cc1OC.Cl |
| InChI | InChI=1S/C14H18N2O4.ClH/c1-18-12-9-11(15-10-13(12)19-2)3-4-14(17)16-5-7-20-8-6-16;/h3-4,9-10H,5-8H2,1-2H3;1H/b4-3+; |
| InChIKey | KXKIYOSQDHEGNJ-BJILWQEISA-N |
| XLogP | 1.39 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|