C19H18Cl2N2O2S — CID 11495205
5,8-dichloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 11495205) has the molecular formula C19H18Cl2N2O2S and a molecular weight of 409.34 g/mol. Its IUPAC name is 5,8-dichloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | 5,8-dichloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 11495205 |
| Molecular Formula | C19H18Cl2N2O2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 5,8-dichloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | Oc1c(O)c(Cl)c2c(c1Cl)CCN(C(=S)N[C@H]1CCc3ccccc31)C2 |
| InChI | InChI=1S/C19H18Cl2N2O2S/c20-15-12-7-8-23(9-13(12)16(21)18(25)17(15)24)19(26)22-14-6-5-10-3-1-2-4-11(10)14/h1-4,14,24-25H,5-9H2,(H,22,26)/t14-/m0/s1 |
| InChIKey | LPIIIYRAVDXVKK-AWEZNQCLSA-N |
| XLogP | 4.32 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|