C16H22N2OS — CID 143468037
N-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioyl]-2,3-dimethylbutanamide (PubChem CID 143468037) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioyl]-2,3-dimethylbutanamide.
| Compound Name | N-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioyl]-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 143468037 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioyl]-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)C(=O)NC(=S)N[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C16H22N2OS/c1-10(2)11(3)15(19)18-16(20)17-14-9-8-12-6-4-5-7-13(12)14/h4-7,10-11,14H,8-9H2,1-3H3,(H2,17,18,19,20)/t11?,14-/m0/s1 |
| InChIKey | LMEHMENBPWZANJ-IAXJKZSUSA-N |
| XLogP | 2.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|