C17H24N2O2S — CID 87629635
2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl 2-methylbutanoate (PubChem CID 87629635) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl 2-methylbutanoate.
| Compound Name | 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 87629635 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCNC(=S)N[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C17H24N2O2S/c1-3-12(2)16(20)21-11-10-18-17(22)19-15-9-8-13-6-4-5-7-14(13)15/h4-7,12,15H,3,8-11H2,1-2H3,(H2,18,19,22)/t12?,15-/m0/s1 |
| InChIKey | AVPVCSKGYBGEAF-CVRLYYSRSA-N |
| XLogP | 2.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|