C18H24N2O2S — CID 16755160
2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl cyclopentanecarboxylate (PubChem CID 16755160) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl cyclopentanecarboxylate.
| Compound Name | 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 16755160 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamothioylamino]ethyl cyclopentanecarboxylate |
| SMILES | O=C(OCCNC(=S)N[C@H]1CCc2ccccc21)C1CCCC1 |
| InChI | InChI=1S/C18H24N2O2S/c21-17(14-6-1-2-7-14)22-12-11-19-18(23)20-16-10-9-13-5-3-4-8-15(13)16/h3-5,8,14,16H,1-2,6-7,9-12H2,(H2,19,20,23)/t16-/m0/s1 |
| InChIKey | UFJCXKJYOHVRJP-INIZCTEOSA-N |
| XLogP | 2.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|