C20H23N3O2S2 — CID 73323467
2-(2,3-dihydro-1H-inden-1-ylcarbamothioylamino)ethyl 2-ethylsulfanylpyridine-3-carboxylate (PubChem CID 73323467) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylcarbamothioylamino)ethyl 2-ethylsulfanylpyridine-3-carboxylate.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylcarbamothioylamino)ethyl 2-ethylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 73323467 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylcarbamothioylamino)ethyl 2-ethylsulfanylpyridine-3-carboxylate |
| SMILES | CCSc1ncccc1C(=O)OCCNC(=S)NC1CCc2ccccc21 |
| InChI | InChI=1S/C20H23N3O2S2/c1-2-27-18-16(8-5-11-21-18)19(24)25-13-12-22-20(26)23-17-10-9-14-6-3-4-7-15(14)17/h3-8,11,17H,2,9-10,12-13H2,1H3,(H2,22,23,26) |
| InChIKey | FVYAURKLFQYURW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|