C19H18FN3O4S — CID 25097967
2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 4-nitrobenzoate (PubChem CID 25097967) has the molecular formula C19H18FN3O4S and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 4-nitrobenzoate.
| Compound Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 25097967 |
| Molecular Formula | C19H18FN3O4S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 4-nitrobenzoate |
| SMILES | O=C(OCCNC(=S)NC1CCc2c(F)cccc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18FN3O4S/c20-16-3-1-2-15-14(16)8-9-17(15)22-19(28)21-10-11-27-18(24)12-4-6-13(7-5-12)23(25)26/h1-7,17H,8-11H2,(H2,21,22,28) |
| InChIKey | UTJHOXSXHOKSRS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|