C17H15ClN2O3 — CID 95795756
[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 95795756) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is [2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 95795756 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Cl)N[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C17H15ClN2O3/c18-16-13(6-3-9-19-16)17(22)23-10-15(21)20-14-8-7-11-4-1-2-5-12(11)14/h1-6,9,14H,7-8,10H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | UNNVWKDRRHGGQM-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|