C17H15ClN2O4 — CID 46828533
[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 46828533) has the molecular formula C17H15ClN2O4 and a molecular weight of 346.77 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 46828533 |
| Molecular Formula | C17H15ClN2O4 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Cl)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C17H15ClN2O4/c18-16-12(5-3-8-19-16)17(22)24-10-15(21)20-13-7-9-23-14-6-2-1-4-11(13)14/h1-6,8,13H,7,9-10H2,(H,20,21) |
| InChIKey | VTKZXIWYOBCWRC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|