About 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol
6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol (PubChem CID 117308042) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 117308042 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Nc1oncc1-c1cc2c(cc1O)CCC2 |
| InChI | InChI=1S/C12H12N2O2/c13-12-10(6-14-16-12)9-4-7-2-1-3-8(7)5-11(9)15/h4-6,15H,1-3,13H2 |
| InChIKey | IQHSQQFNJCFVOY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol (CID 117308042) is 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol is Nc1oncc1-c1cc2c(cc1O)CCC2.
What is the InChIKey of 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is IQHSQQFNJCFVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c13-12-10(6-14-16-12)9-4-7-2-1-3-8(7)5-11(9)15/h4-6,15H,1-3,13H2.
What are the key properties of 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol?
6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 216.24 g/mol, XLogP of 2.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-amino-1,2-oxazol-4-yl)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 117308042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).