C10H10N2O2S — CID 117318069
3-(5-amino-1,2-oxazol-4-yl)-2-methylsulfanylphenol (PubChem CID 117318069) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-(5-amino-1,2-oxazol-4-yl)-2-methylsulfanylphenol.
| Compound Name | 3-(5-amino-1,2-oxazol-4-yl)-2-methylsulfanylphenol |
|---|---|
| PubChem CID | 117318069 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-(5-amino-1,2-oxazol-4-yl)-2-methylsulfanylphenol |
| SMILES | CSc1c(O)cccc1-c1cnoc1N |
| InChI | InChI=1S/C10H10N2O2S/c1-15-9-6(3-2-4-8(9)13)7-5-12-14-10(7)11/h2-5,13H,11H2,1H3 |
| InChIKey | LVYLSIZPSDLGRY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |