C9H7FN2O3 — CID 117299784
4-(5-amino-1,2-oxazol-4-yl)-2-fluorobenzene-1,3-diol (PubChem CID 117299784) has the molecular formula C9H7FN2O3 and a molecular weight of 210.16 g/mol. Its IUPAC name is 4-(5-amino-1,2-oxazol-4-yl)-2-fluorobenzene-1,3-diol.
| Compound Name | 4-(5-amino-1,2-oxazol-4-yl)-2-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 117299784 |
| Molecular Formula | C9H7FN2O3 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 4-(5-amino-1,2-oxazol-4-yl)-2-fluorobenzene-1,3-diol |
| SMILES | Nc1oncc1-c1ccc(O)c(F)c1O |
| InChI | InChI=1S/C9H7FN2O3/c10-7-6(13)2-1-4(8(7)14)5-3-12-15-9(5)11/h1-3,13-14H,11H2 |
| InChIKey | AMSHJRMXOBWPLL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |