C11H10F2N2O2 — CID 117352525
4-[2,3-difluoro-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117352525) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-[2,3-difluoro-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117352525 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-[2,3-difluoro-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine |
| SMILES | COCc1ccc(-c2cnoc2N)c(F)c1F |
| InChI | InChI=1S/C11H10F2N2O2/c1-16-5-6-2-3-7(10(13)9(6)12)8-4-15-17-11(8)14/h2-4H,5,14H2,1H3 |
| InChIKey | ODNCEWIYDNVWIY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |