C11H12N2O2 — CID 117292468
3-(5-amino-1,2-oxazol-4-yl)-2,6-dimethylphenol (PubChem CID 117292468) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-(5-amino-1,2-oxazol-4-yl)-2,6-dimethylphenol.
| Compound Name | 3-(5-amino-1,2-oxazol-4-yl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 117292468 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-(5-amino-1,2-oxazol-4-yl)-2,6-dimethylphenol |
| SMILES | Cc1ccc(-c2cnoc2N)c(C)c1O |
| InChI | InChI=1S/C11H12N2O2/c1-6-3-4-8(7(2)10(6)14)9-5-13-15-11(9)12/h3-5,14H,12H2,1-2H3 |
| InChIKey | DQLVOTKLRTYTAN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |