C11H12N2OS2 — CID 117384436
4-[2,4-bis(methylsulfanyl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117384436) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-[2,4-bis(methylsulfanyl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-[2,4-bis(methylsulfanyl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117384436 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-[2,4-bis(methylsulfanyl)phenyl]-1,2-oxazol-5-amine |
| SMILES | CSc1ccc(-c2cnoc2N)c(SC)c1 |
| InChI | InChI=1S/C11H12N2OS2/c1-15-7-3-4-8(10(5-7)16-2)9-6-13-14-11(9)12/h3-6H,12H2,1-2H3 |
| InChIKey | FSQRKZGRJWPZNL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |