C14H19NO — CID 117309765
6-(1-aminocyclopentyl)-2,3-dihydro-1H-inden-5-ol (PubChem CID 117309765) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 6-(1-aminocyclopentyl)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 6-(1-aminocyclopentyl)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 117309765 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 6-(1-aminocyclopentyl)-2,3-dihydro-1H-inden-5-ol |
| SMILES | NC1(c2cc3c(cc2O)CCC3)CCCC1 |
| InChI | InChI=1S/C14H19NO/c15-14(6-1-2-7-14)12-8-10-4-3-5-11(10)9-13(12)16/h8-9,16H,1-7,15H2 |
| InChIKey | HPKVGCDEINWIBK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|