C11H13NO3 — CID 96620005
2,3,4,7,8,9-hexahydro-[1,4]dioxepino[2,3-f]indol-10-ol (PubChem CID 96620005) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2,3,4,7,8,9-hexahydro-[1,4]dioxepino[2,3-f]indol-10-ol.
| Compound Name | 2,3,4,7,8,9-hexahydro-[1,4]dioxepino[2,3-f]indol-10-ol |
|---|---|
| PubChem CID | 96620005 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2,3,4,7,8,9-hexahydro-[1,4]dioxepino[2,3-f]indol-10-ol |
| SMILES | Oc1c2c(cc3c1OCCCO3)NCC2 |
| InChI | InChI=1S/C11H13NO3/c13-10-7-2-3-12-8(7)6-9-11(10)15-5-1-4-14-9/h6,12-13H,1-5H2 |
| InChIKey | UPZNINASYIZGTM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|