C11H15NO3 — CID 117298696
7-(1-aminoethyl)-3,4-dihydro-2H-1,5-benzodioxepin-6-ol (PubChem CID 117298696) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 7-(1-aminoethyl)-3,4-dihydro-2H-1,5-benzodioxepin-6-ol.
| Compound Name | 7-(1-aminoethyl)-3,4-dihydro-2H-1,5-benzodioxepin-6-ol |
|---|---|
| PubChem CID | 117298696 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 7-(1-aminoethyl)-3,4-dihydro-2H-1,5-benzodioxepin-6-ol |
| SMILES | CC(N)c1ccc2c(c1O)OCCCO2 |
| InChI | InChI=1S/C11H15NO3/c1-7(12)8-3-4-9-11(10(8)13)15-6-2-5-14-9/h3-4,7,13H,2,5-6,12H2,1H3 |
| InChIKey | YPDRXMHSNLBTNC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|