C11H15NO2 — CID 68796634
1-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)ethanamine (PubChem CID 68796634) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)ethanamine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)ethanamine |
|---|---|
| PubChem CID | 68796634 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)ethanamine |
| SMILES | CC(N)c1cccc2c1OCCCO2 |
| InChI | InChI=1S/C11H15NO2/c1-8(12)9-4-2-5-10-11(9)14-7-3-6-13-10/h2,4-5,8H,3,6-7,12H2,1H3 |
| InChIKey | NDOIPEMMAVOAJD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |