C15H21NO2 — CID 105079651
cyclohexyl(2,3-dihydro-1,4-benzodioxin-5-yl)methanamine (PubChem CID 105079651) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is cyclohexyl(2,3-dihydro-1,4-benzodioxin-5-yl)methanamine.
| Compound Name | cyclohexyl(2,3-dihydro-1,4-benzodioxin-5-yl)methanamine |
|---|---|
| PubChem CID | 105079651 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | cyclohexyl(2,3-dihydro-1,4-benzodioxin-5-yl)methanamine |
| SMILES | NC(c1cccc2c1OCCO2)C1CCCCC1 |
| InChI | InChI=1S/C15H21NO2/c16-14(11-5-2-1-3-6-11)12-7-4-8-13-15(12)18-10-9-17-13/h4,7-8,11,14H,1-3,5-6,9-10,16H2 |
| InChIKey | IWZPKNKOLFNVGO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |