C17H22BIO3 — CID 67554786
(6S)-6-iodo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,8,9-tetrahydrobenzo[7]annulen-7-one (PubChem CID 67554786) has the molecular formula C17H22BIO3 and a molecular weight of 412.08 g/mol. Its IUPAC name is (6S)-6-iodo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,8,9-tetrahydrobenzo[7]annulen-7-one.
| Compound Name | (6S)-6-iodo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,8,9-tetrahydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 67554786 |
| Molecular Formula | C17H22BIO3 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (6S)-6-iodo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,8,9-tetrahydrobenzo[7]annulen-7-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCC(=O)[C@@H](I)C3)OC1(C)C |
| InChI | InChI=1S/C17H22BIO3/c1-16(2)17(3,4)22-18(21-16)13-7-5-12-10-14(19)15(20)8-6-11(12)9-13/h5,7,9,14H,6,8,10H2,1-4H3/t14-/m0/s1 |
| InChIKey | NHYMSLVNBMHEDA-AWEZNQCLSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|