C15H19BF2O3 — CID 162341356
2-(4,4-difluoro-2,3-dihydrochromen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162341356) has the molecular formula C15H19BF2O3 and a molecular weight of 296.12 g/mol. Its IUPAC name is 2-(4,4-difluoro-2,3-dihydrochromen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4,4-difluoro-2,3-dihydrochromen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162341356 |
| Molecular Formula | C15H19BF2O3 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-(4,4-difluoro-2,3-dihydrochromen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)OCCC3(F)F)OC1(C)C |
| InChI | InChI=1S/C15H19BF2O3/c1-13(2)14(3,4)21-16(20-13)10-5-6-11-12(9-10)19-8-7-15(11,17)18/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | FCJGCMBACKICJE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|