C30H43BO10 — CID 71528395
4,4,5,5-tetramethyl-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-yl)-1,3,2-dioxaborolane (PubChem CID 71528395) has the molecular formula C30H43BO10 and a molecular weight of 574.48 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 71528395 |
| Molecular Formula | C30H43BO10 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)OCCOCCOCCOc2ccccc2OCCOCCOCCO3)OC1(C)C |
| InChI | InChI=1S/C30H43BO10/c1-29(2)30(3,4)41-31(40-29)24-9-10-27-28(23-24)39-22-18-35-14-13-33-16-20-37-26-8-6-5-7-25(26)36-19-15-32-11-12-34-17-21-38-27/h5-10,23H,11-22H2,1-4H3 |
| InChIKey | IRXDCOOLSHHWMO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|